acetic acid,(1-chloro-3-hydroxypropan-2-yl)oxymethyl acetate structure
|
Common Name | acetic acid,(1-chloro-3-hydroxypropan-2-yl)oxymethyl acetate | ||
|---|---|---|---|---|
| CAS Number | 86761-37-7 | Molecular Weight | 242.65400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15ClO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,(1-chloro-3-hydroxypropan-2-yl)oxymethyl acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H15ClO6 |
|---|---|
| Molecular Weight | 242.65400 |
| Exact Mass | 242.05600 |
| PSA | 93.06000 |
| LogP | 0.21420 |
| InChIKey | ONQJDXOAKWOFDM-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)OCOC(CO)CCl |
|
~%
acetic acid,(1-... CAS#:86761-37-7 |
| Literature: Senkus Journal of the American Chemical Society, 1946 , vol. 68, p. 735 |
|
~%
acetic acid,(1-... CAS#:86761-37-7 |
| Literature: Bailey, William F.; Rivera, Alberto D. Journal of Organic Chemistry, 1984 , vol. 49, # 25 p. 4958 - 4964 |
|
~%
acetic acid,(1-... CAS#:86761-37-7 |
| Literature: Senkus Journal of the American Chemical Society, 1949 , vol. 68, p. 734 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-acetoxy-2-acetoxymethoxy-3-chloro-propane |
| 1-Propanol,2-[(acetyloxy)methoxy]-3-chloro-,acetate |
| 1-Acetoxy-2-acetoxymethoxy-3-chlor-propan |