(2Z)-5-Bromo-5-methyl-3-phenyl-2-(phenylimino)-1,3-thiazinan-4-on e structure
|
Common Name | (2Z)-5-Bromo-5-methyl-3-phenyl-2-(phenylimino)-1,3-thiazinan-4-on e | ||
|---|---|---|---|---|
| CAS Number | 86727-00-6 | Molecular Weight | 375.28300 | |
| Density | 1.41g/cm3 | Boiling Point | 470ºC at 760 mmHg | |
| Molecular Formula | C17H15BrN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.1ºC | |
| Name | (2Z)-5-Bromo-5-methyl-3-phenyl-2-(phenylimino)-1,3-thiazinan-4-on e |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 470ºC at 760 mmHg |
| Molecular Formula | C17H15BrN2OS |
| Molecular Weight | 375.28300 |
| Flash Point | 238.1ºC |
| Exact Mass | 374.00900 |
| PSA | 57.97000 |
| LogP | 4.67270 |
| Index of Refraction | 1.651 |
| InChIKey | ASZBPWIGUHLPML-UHFFFAOYSA-N |
| SMILES | CC1(Br)CSC(=Nc2ccccc2)N(c2ccccc2)C1=O |
|
~62%
(2Z)-5-Bromo-5-... CAS#:86727-00-6 |
| Literature: Okawara, Tadashi; Nakayama, Kentaro; Furukawa, Mitsuru Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 2 p. 507 - 512 |