2-methyl-5-[(5-methylfuran-2-yl)-phenylmethyl]furan
Modify Date: 2025-09-13 19:15:20
![2-methyl-5-[(5-methylfuran-2-yl)-phenylmethyl]furan Structure](https://image.chemsrc.com/caspic/193/86694-47-5.png)
2-methyl-5-[(5-methylfuran-2-yl)-phenylmethyl]furan structure
|
Common Name | 2-methyl-5-[(5-methylfuran-2-yl)-phenylmethyl]furan | ||
|---|---|---|---|---|
| CAS Number | 86694-47-5 | Molecular Weight | 252.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-5-[(5-methylfuran-2-yl)-phenylmethyl]furan |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16O2 |
|---|---|
| Molecular Weight | 252.30800 |
| Exact Mass | 252.11500 |
| PSA | 26.28000 |
| LogP | 4.66960 |
| InChIKey | QLZTYUYHMZDOCP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(c2ccccc2)c2ccc(C)o2)o1 |
|
~80%
2-methyl-5-[(5-... CAS#:86694-47-5 |
| Literature: Dhiman, Seema; Ramasastry Organic and Biomolecular Chemistry, 2013 , vol. 11, # 46 p. 8030 - 8035 |
|
~%
2-methyl-5-[(5-... CAS#:86694-47-5 |
| Literature: Katritzky, Alan R.; Xie, Linghong; Fan, Wei-Qiang Journal of Organic Chemistry, 1993 , vol. 58, # 16 p. 4376 - 4381 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![2-methyl-5-[(5-methylthiophen-2-yl)-phenylmethyl]thiophene structure](https://image.chemsrc.com/caspic/009/126045-46-3.png)
CAS#:126045-46-3| phenyldi(5-methyl-2-furyl)methane |
| 2-Methyl-5-[(5-methyl-2-furyl)(phenyl)methyl]furan |
| bis(5-methylfur-2-yl)phenylmethane |
| 2-methyl-5-[(5-methylfuran-2-yl)(phenyl)methyl]furan |
| 2,2'-Benzylidenebis(5-methylfuran) |
| Furan,2,2'-(phenylmethylene)bis[5-methyl |
| bis[(5-methyl)-2-furyl]phenyl methane |