Setipiprant structure
|
Common Name | Setipiprant | ||
|---|---|---|---|---|
| CAS Number | 866460-33-5 | Molecular Weight | 402.418 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 690.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H19FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.4±31.5 °C | |
Use of SetipiprantSetipiprant is an orally available, selective CRTH2 antagonist. CRTH2 is a G protein-coupled receptor for PGD2.IC50 value: 6.0 nMTarget: PGD2in vitro: Setipiprant is an orally available, selective CRTH2 (chemoattractant receptor-homologous molecule expressed on T helper [Th]-2 cells) antagonist. CRTH2 is a G protein-coupled receptor for prostaglandin (PGD2). PGD2 is produced by the mast cells and is a key mediator in various inflammatory diseases, including allergy and asthma. Binding of PGD2 to CRTH2, which are expressed on the surface of blood-borne cells, induces chemotaxis of Th2 cells, basophils, and eosinophils, and stimulates cytokine release from these cells. Thus, antagonism of CRTH2 receptors is considered to be a promising therapeutic target for various allergic diseases and asthma. |
| Name | 2-[8-fluoro-2-(naphthalene-1-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Setipiprant is an orally available, selective CRTH2 antagonist. CRTH2 is a G protein-coupled receptor for PGD2.IC50 value: 6.0 nMTarget: PGD2in vitro: Setipiprant is an orally available, selective CRTH2 (chemoattractant receptor-homologous molecule expressed on T helper [Th]-2 cells) antagonist. CRTH2 is a G protein-coupled receptor for prostaglandin (PGD2). PGD2 is produced by the mast cells and is a key mediator in various inflammatory diseases, including allergy and asthma. Binding of PGD2 to CRTH2, which are expressed on the surface of blood-borne cells, induces chemotaxis of Th2 cells, basophils, and eosinophils, and stimulates cytokine release from these cells. Thus, antagonism of CRTH2 receptors is considered to be a promising therapeutic target for various allergic diseases and asthma. |
|---|---|
| Related Catalog |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 690.4±55.0 °C at 760 mmHg |
| Molecular Formula | C24H19FN2O3 |
| Molecular Weight | 402.418 |
| Flash Point | 371.4±31.5 °C |
| Exact Mass | 402.137970 |
| PSA | 62.54000 |
| LogP | 3.39 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | IHAXLPDVOWLUOS-UHFFFAOYSA-N |
| SMILES | O=C(O)Cn1c2c(c3cc(F)ccc31)CN(C(=O)c1cccc3ccccc13)CC2 |
| Storage condition | -20℃ |
| [8-Fluoro-2-(1-naphthoyl)-1,2,3,4-tetrahydro-5H-pyrido[4,3-b]indol-5-yl]acetic acid |
| Setipiprant |
| 5H-Pyrido[4,3-b]indole-5-acetic acid, 8-fluoro-1,2,3,4-tetrahydro-2-(1-naphthalenylcarbonyl)- |
| UNII-BHF20LA2GM |
| 2-(2-(1-Naphthoyl)-8-fluoro-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)acetic acid |
| ACT-129968 |