N-[2-(6-bromo-1H-indol-3-yl)ethyl]-2,2-dimethylpropanamide structure
|
Common Name | N-[2-(6-bromo-1H-indol-3-yl)ethyl]-2,2-dimethylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 86626-36-0 | Molecular Weight | 323.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(6-bromo-1H-indol-3-yl)ethyl]-2,2-dimethylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H19BrN2O |
|---|---|
| Molecular Weight | 323.22800 |
| Exact Mass | 322.06800 |
| PSA | 48.38000 |
| LogP | 4.47550 |
| InChIKey | QSKTUNDTWHGOFK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NCCc1c[nH]c2cc(Br)ccc12 |
|
~%
N-[2-(6-bromo-1... CAS#:86626-36-0 |
| Literature: Kawase, Masami; Miyake, Yuko; Kikugawa, Yasuo Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 7 p. 1401 - 1404 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Propanamide,N-[2-(6-bromo-1H-indol-3-yl)ethyl]-2,2-dimethyl |