2-Phenyldihydroimidazo(1,5-c)(1,3)thiazine-1,3(2H,7H)-dione structure
|
Common Name | 2-Phenyldihydroimidazo(1,5-c)(1,3)thiazine-1,3(2H,7H)-dione | ||
|---|---|---|---|---|
| CAS Number | 86625-94-7 | Molecular Weight | 248.30100 | |
| Density | 1.43g/cm3 | Boiling Point | 394.5ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.4ºC | |
| Name | 2-phenyl-5,7,8,8a-tetrahydroimidazo[1,5-c][1,3]thiazine-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 394.5ºC at 760 mmHg |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.30100 |
| Flash Point | 192.4ºC |
| Exact Mass | 248.06200 |
| PSA | 65.92000 |
| LogP | 1.92110 |
| Index of Refraction | 1.694 |
| InChIKey | MCAPLTNKUWRKLH-UHFFFAOYSA-N |
| SMILES | O=C1C2CCSCN2C(=O)N1c1ccccc1 |
|
~95%
2-Phenyldihydro... CAS#:86625-94-7 |
| Literature: Lalezari, I.; Seifter, S.; Thein, A. Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 483 - 485 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Phenyldihydroimidazo[1,5-c][1,3]thiazine-1,3(2H,7H)-dione |
| 2-phenyl-7,8-dihydro-5H-imidazo<1,5-c><1,3>thiazine-1,3-<2H,8aH>-dione |