2-(2,6-dibromophenoxy)ethanol,4-methylbenzenesulfonic acid structure
|
Common Name | 2-(2,6-dibromophenoxy)ethanol,4-methylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 865756-51-0 | Molecular Weight | 468.15800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16Br2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,6-dibromophenoxy)ethanol,4-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16Br2O5S |
|---|---|
| Molecular Weight | 468.15800 |
| Exact Mass | 465.90900 |
| PSA | 92.21000 |
| LogP | 4.90520 |
| InChIKey | IESKCYAJQJNZLG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.OCCOc1c(Br)cccc1Br |
|
~82%
2-(2,6-dibromop... CAS#:865756-51-0 |
| Literature: Tominaga, Masahide; Suzuki, Kosuke; Murase, Takashi; Fujita, Makoto Journal of the American Chemical Society, 2005 , vol. 127, # 34 p. 11950 - 11951 |
| 1,3-dibromo-2-[2-(p-toluenesulfonyloxy)ethoxy]benzene |
| Ethanol,2-(2,6-dibromophenoxy)-,4-methylbenzenesulfonate |