Giripladib
Modify Date: 2025-08-25 22:57:24
Giripladib structure
|
Common Name | Giripladib | ||
|---|---|---|---|---|
| CAS Number | 865200-20-0 | Molecular Weight | 745.25 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C41H36ClF3N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GiripladibGiripladib (PLA-695) is a indole-based inhibitor of cytosolic phospholipase A2 (cPLA2). Giripladib can be used for osteoarthritis and breast cancer research[1][2]. |
| Name | Giripladib |
|---|---|
| Synonym | More Synonyms |
| Description | Giripladib (PLA-695) is a indole-based inhibitor of cytosolic phospholipase A2 (cPLA2). Giripladib can be used for osteoarthritis and breast cancer research[1][2]. |
|---|---|
| Related Catalog | |
| Target |
cPLA2α |
| References |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C41H36ClF3N2O4S |
| Molecular Weight | 745.25 |
| Exact Mass | 744.20400 |
| PSA | 96.78000 |
| LogP | 10.95850 |
| InChIKey | NHHBNHIPCSPSHQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(CCCc2c(CCNS(=O)(=O)Cc3ccccc3C(F)(F)F)n(C(c3ccccc3)c3ccccc3)c3ccc(Cl)cc23)cc1 |
| Storage condition | -20°C |
| PLA 695 |
| 4-[3-[1-benzhydryl-5-chloro-2-[2-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]ethyl]indol-3-yl]propyl]benzoic acid |