3aH-Isoxazolo[2,3-b]isoxazole-3a-carboxylicacid, tetrahydro-2,5-bis[(4-nitrophenoxy)methyl]-, ethyl ester structure
|
Common Name | 3aH-Isoxazolo[2,3-b]isoxazole-3a-carboxylicacid, tetrahydro-2,5-bis[(4-nitrophenoxy)methyl]-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 86497-70-3 | Molecular Weight | 489.43200 | |
| Density | 1.46g/cm3 | Boiling Point | 625.6ºC at 760mmHg | |
| Molecular Formula | C22H23N3O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.2ºC | |
| Name | ethyl 2,5-bis[(4-nitrophenoxy)methyl]-2,3,4,5-tetrahydro-[1,2]oxazolo[2,3-b][1,2]oxazole-3a-carboxylate |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 625.6ºC at 760mmHg |
| Molecular Formula | C22H23N3O10 |
| Molecular Weight | 489.43200 |
| Flash Point | 332.2ºC |
| Exact Mass | 489.13800 |
| PSA | 158.10000 |
| LogP | 3.95680 |
| Index of Refraction | 1.629 |
| InChIKey | JYPNLARXDNGGOJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C12CC(COc3ccc([N+](=O)[O-])cc3)ON1OC(COc1ccc([N+](=O)[O-])cc1)C2 |
|
~74%
3aH-Isoxazolo[2... CAS#:86497-70-3 |
| Literature: Shimizu, Tomio; Hayashi, Yoshiyuki; Teramura, Kazuhiro Journal of Organic Chemistry, 1983 , vol. 48, # 18 p. 3053 - 3058 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |