Mesendogen structure
|
Common Name | Mesendogen | ||
|---|---|---|---|---|
| CAS Number | 864716-85-8 | Molecular Weight | 400.85 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16ClF3N2Os | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MesendogenNovel inhibitor of TRPM6, promoting mesoderm and definitive endoderm differentiation of human embryonic stem cells through alteration of magnesium homeostasis |
| Name | Mesendogen |
|---|
| Description | Novel inhibitor of TRPM6, promoting mesoderm and definitive endoderm differentiation of human embryonic stem cells through alteration of magnesium homeostasis |
|---|
| Molecular Formula | C18H16ClF3N2Os |
|---|---|
| Molecular Weight | 400.85 |
| InChIKey | VVFIVYCBLSSVEK-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(C(=O)NC(=S)Nc2cc(C(F)(F)F)ccc2Cl)cc1 |