2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone structure
|
Common Name | 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 86471-07-0 | Molecular Weight | 444.11600 | |
| Density | 1.766g/cm3 | Boiling Point | 567.6ºC at 760 mmHg | |
| Molecular Formula | C20H12Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.766g/cm3 |
|---|---|
| Boiling Point | 567.6ºC at 760 mmHg |
| Molecular Formula | C20H12Br2O2 |
| Molecular Weight | 444.11600 |
| Flash Point | 157ºC |
| Exact Mass | 441.92000 |
| PSA | 34.14000 |
| LogP | 5.73920 |
| Index of Refraction | 1.805 |
| InChIKey | FPAZFQWRTMEJSY-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc2ccc3ccc(C(=O)CBr)c4ccc1c2c34 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~77%
2-bromo-1-[8-(2... CAS#:86471-07-0 |
| Literature: Harvey, Ronald G.; Konieczny, Maria; Pataki, John Journal of Organic Chemistry, 1983 , vol. 48, # 17 p. 2930 - 2932 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,8-bis(bromoacetyl)pyrene |
| 1,1'-pyrene-1,8-diylbis(2-bromoethanone) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 86471-07-0? |
| A: Chinese name of 86471-07-0 is 86471-07-0. |
| Q: What is the molecular formula of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone? |
| A: Molecular formula of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone is C20H12Br2O2. |
| Q: What is the polar surface area (PSA) of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone? |
| A: Polar surface area (PSA) of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone is 34.14000. |
| Q: What is the InChIKey of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone? |
| A: InChIKey of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone is FPAZFQWRTMEJSY-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone? |
| A: LogP of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone is 5.73920. |
| Q: What is the CAS number of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone? |
| A: CAS number of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone is 86471-07-0. |
| Q: What English synonyms does 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone have? |
| A: English synonyms of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone: 1,8-bis(bromoacetyl)pyrene, 1,1'-pyrene-1,8-diylbis(2-bromoethanone). |
| Q: What is the molecular weight of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone? |
| A: Molecular weight of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone is 444.11600. |
| Q: What is the SMILES notation of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone? |
| A: SMILES notation of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone is O=C(CBr)c1ccc2ccc3ccc(C(=O)CBr)c4ccc1c2c34. |
| Q: What is the boiling point of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone? |
| A: Boiling point of 2-bromo-1-[8-(2-bromoacetyl)pyren-1-yl]ethanone is 567.6ºC at 760 mmHg. |