3-nitro-9H-carbazol-2-amine
Modify Date: 2025-09-23 11:01:56
3-nitro-9H-carbazol-2-amine structure
|
Common Name | 3-nitro-9H-carbazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 86439-49-8 | Molecular Weight | 227.21900 | |
| Density | 1.513g/cm3 | Boiling Point | 524.6ºC at 760mmHg | |
| Molecular Formula | C12H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.1ºC | |
| Name | 3-nitro-9H-carbazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.513g/cm3 |
|---|---|
| Boiling Point | 524.6ºC at 760mmHg |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.21900 |
| Flash Point | 271.1ºC |
| Exact Mass | 227.06900 |
| PSA | 87.63000 |
| LogP | 3.91590 |
| InChIKey | YWXUPCLUXSCTOD-UHFFFAOYSA-N |
| SMILES | Nc1cc2[nH]c3ccccc3c2cc1[N+](=O)[O-] |
|
~81%
3-nitro-9H-carb... CAS#:86439-49-8 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 1 p. 45 - 51 |
|
~%
3-nitro-9H-carb... CAS#:86439-49-8 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 1 p. 45 - 51 |
| 9H-Carbazol-2-amine,3-nitro |
| 3-Nitro-2-aminocarbazole |
| amino-2 nitro-3 carbazole |
| 2-Amino-3-nitro-9H-carbazole |
| 2-amino-3-nitrocarbazole |