2,4-Dichloro-7-quinazolinecarbonitrile
Modify Date: 2025-09-02 20:02:16
2,4-Dichloro-7-quinazolinecarbonitrile structure
|
Common Name | 2,4-Dichloro-7-quinazolinecarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 864292-40-0 | Molecular Weight | 224.046 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 354.9±24.0 °C at 760 mmHg | |
| Molecular Formula | C9H3Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.5±22.9 °C | |
| Name | 2,4-Dichloroquinazoline-7-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.9±24.0 °C at 760 mmHg |
| Molecular Formula | C9H3Cl2N3 |
| Molecular Weight | 224.046 |
| Flash Point | 168.5±22.9 °C |
| Exact Mass | 222.970398 |
| PSA | 49.57000 |
| LogP | 2.39 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | VLCHPTOMKJWDMG-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc2c(Cl)nc(Cl)nc2c1 |
| HS Code | 2933990090 |
|---|
|
~%
2,4-Dichloro-7-... CAS#:864292-40-0 |
| Literature: WO2005/123697 A1, ; Page/Page column 22 ; WO 2005/123697 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Dichloro-7-quinazolinecarbonitrile |
| 2,4-dichloro-7-cyanoquinazoline |
| 2,4-dichloroquinazoline-7-carbonitrile |
| 7-Quinazolinecarbonitrile, 2,4-dichloro- |