tert-butyl 4-(3-hydroxypiperidin-1-yl)piperidine-1-carboxylate
Modify Date: 2025-01-13 11:07:36
tert-butyl 4-(3-hydroxypiperidin-1-yl)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-(3-hydroxypiperidin-1-yl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 864291-87-2 | Molecular Weight | 284.39400 | |
| Density | 1.125g/cm3 | Boiling Point | 391.277ºC at 760 mmHg | |
| Molecular Formula | C15H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.438ºC | |
| Name | tert-butyl 4-(3-hydroxypiperidin-1-yl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 391.277ºC at 760 mmHg |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.39400 |
| Flash Point | 190.438ºC |
| Exact Mass | 284.21000 |
| PSA | 53.01000 |
| LogP | 1.71840 |
| Index of Refraction | 1.527 |
| InChIKey | UZONPELMGKAXTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCCC(O)C2)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
tert-butyl 4-(3... CAS#:864291-87-2 |
| Literature: Yokoyama, Kazuhiro; Ishikawa, Noriko; Igarashi, Susumu; Kawano, Noriyuki; Masuda, Naoyuki; Hamaguchi, Wataru; Yamasaki, Shingo; Koganemaru, Yohei; Hattori, Kazuyuki; Miyazaki, Takahiro; Ogino, Shin-ichi; Matsumoto, Yuzo; Takeuchi, Makoto; Ohta, Mitsuaki Bioorganic and Medicinal Chemistry, 2009 , vol. 17, # 1 p. 64 - 73 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 3-hydroxy-1,4'-bipiperidine-1'-carboxylate |