Phthalazine,1-hydrazinyl-4-phenyl-
Modify Date: 2025-09-18 01:40:18
Phthalazine,1-hydrazinyl-4-phenyl- structure
|
Common Name | Phthalazine,1-hydrazinyl-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 86427-78-3 | Molecular Weight | 236.27200 | |
| Density | 1.298g/cm3 | Boiling Point | 537.4ºC at 760 mmHg | |
| Molecular Formula | C14H12N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.8ºC | |
| Name | (4-phenylphthalazin-1-yl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 537.4ºC at 760 mmHg |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.27200 |
| Flash Point | 278.8ºC |
| Exact Mass | 236.10600 |
| PSA | 63.83000 |
| LogP | 3.35570 |
| Index of Refraction | 1.74 |
| InChIKey | OZXCKWJNGZVAAJ-UHFFFAOYSA-N |
| SMILES | NNc1nnc(-c2ccccc2)c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~%
Phthalazine,1-h... CAS#:86427-78-3 |
| Literature: CIBA Patent: US2484029 , 1946 ; |
|
~%
Phthalazine,1-h... CAS#:86427-78-3 |
| Literature: Hemdan, Magdy M.; Taha, Sherif M.; Gabr, Adel M.; Elkady, Mohamed Y. Journal of Chemical Research, 2010 , # 2 p. 102 - 105 |
CAS#:21517-01-1![3-methyl-6-phenyl-[1,2,4]triazolo[3,4-a]phthalazine structure](https://image.chemsrc.com/caspic/236/21517-02-2.png)
CAS#:21517-02-2
CAS#:87540-68-9![6-phenyl-2H-[1,2,4]triazolo[3,4-a]phthalazine-3-thione structure](https://image.chemsrc.com/caspic/084/87540-71-4.png)
CAS#:87540-71-4![3-methylsulfanyl-6-phenyl-[1,2,4]triazolo[3,4-a]phthalazine structure](https://image.chemsrc.com/caspic/263/87540-84-9.png)
CAS#:87540-84-9| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-hydrazinyl-4-phenylphthalazine |
| (4-Phenyl-Phthalazin-1-Yl)-Hydrazine |
| 4-Phenyl-1-phthalazinylhydrazine |
| 4-phenylphthalazinylhydrazine |
| 1-hydrazino-4-phenylphthalazine |
| (4-Phenyl-phthalazin-1-yl)-hydrazin |