Ethyl 3-bromo-4-cyanobenzoate structure
|
Common Name | Ethyl 3-bromo-4-cyanobenzoate | ||
|---|---|---|---|---|
| CAS Number | 86400-57-9 | Molecular Weight | 254.080 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 360.6±32.0 °C at 760 mmHg | |
| Molecular Formula | C10H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.9±25.1 °C | |
| Name | Ethyl 3-bromo-4-cyanobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.6±32.0 °C at 760 mmHg |
| Molecular Formula | C10H8BrNO2 |
| Molecular Weight | 254.080 |
| Flash Point | 171.9±25.1 °C |
| Exact Mass | 252.973831 |
| PSA | 50.09000 |
| LogP | 2.86 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | FBZRWCVSAQPVIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc([N+](=O)[O-])c(Br)c1 |
|
~79%
Ethyl 3-bromo-4... CAS#:86400-57-9 |
| Literature: Decodts; Wakselman European Journal of Medicinal Chemistry, 1983 , vol. 18, # 2 p. 107 - 111 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 3-Bromo-2-fluorobenzoic acid ethyl ester |
| ethyl 3-bromo-4-nitro-benzoate |
| Ethyl 3-bromo-4-cyanobenzoate |
| Benzoic acid, 3-bromo-4-cyano-, ethyl ester |