2-Propen-1-one,1-(4-chlorophenyl)-3-(4-hydroxyphenyl)-
Modify Date: 2025-08-25 08:20:30
2-Propen-1-one,1-(4-chlorophenyl)-3-(4-hydroxyphenyl)- structure
|
Common Name | 2-Propen-1-one,1-(4-chlorophenyl)-3-(4-hydroxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 86293-53-0 | Molecular Weight | 258.70000 | |
| Density | 1.292g/cm3 | Boiling Point | 433.8ºC at 760mmHg | |
| Molecular Formula | C15H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.1ºC | |
| Name | (E)-1-(4-chlorophenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 433.8ºC at 760mmHg |
| Molecular Formula | C15H11ClO2 |
| Molecular Weight | 258.70000 |
| Flash Point | 216.1ºC |
| Exact Mass | 258.04500 |
| PSA | 37.30000 |
| LogP | 3.94170 |
| Index of Refraction | 1.659 |
| InChIKey | JQKBSQAFXLEIII-XCVCLJGOSA-N |
| SMILES | O=C(C=Cc1ccc(O)cc1)c1ccc(Cl)cc1 |
|
~96%
2-Propen-1-one,... CAS#:86293-53-0 |
| Literature: Bai, Xue; Shi, Wan Qi; Chen, Hua Feng; Zhang, Ping; Li, Ying; Yin, Shu Fan Chemistry of Natural Compounds, 2012 , vol. 48, # 1 p. 60 - 65 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4'-Chlor-4-hydroxy-chalkon |
| 4-hydroxy-4'-chlorochalcone |