Maropitant citrate
Modify Date: 2025-08-25 09:30:14
Maropitant citrate structure
|
Common Name | Maropitant citrate | ||
|---|---|---|---|---|
| CAS Number | 862543-54-2 | Molecular Weight | 660.79600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H48N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Maropitant citrateMaropitant citrate (Cerenia) is a selective neurokinin 1 receptor (NK1) antagonist for prevention of vomiting due to motion sickness in dogs.. |
| Name | (2S,3S)-2-benzhydryl-N-[(5-tert-butyl-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine,2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C38H48N2O8 |
|---|---|
| Molecular Weight | 660.79600 |
| Exact Mass | 660.34100 |
| PSA | 156.63000 |
| LogP | 5.45750 |
| InChIKey | XDZPFSKCXRGRIO-PNXDLZEOSA-N |
| SMILES | COc1ccc(C(C)(C)C)cc1CNC1C2CCN(CC2)C1C(c1ccccc1)c1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| Maropitant citrate anhydrous |