(1-((3,5-Dichlorophenyl)amino)cyclopropyl)Methanol
Modify Date: 2025-09-23 10:03:27
(1-((3,5-Dichlorophenyl)amino)cyclopropyl)Methanol structure
|
Common Name | (1-((3,5-Dichlorophenyl)amino)cyclopropyl)Methanol | ||
|---|---|---|---|---|
| CAS Number | 861648-82-0 | Molecular Weight | 232.10600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-(3,5-dichloroanilino)cyclopropyl]methanol |
|---|
| Molecular Formula | C10H11Cl2NO |
|---|---|
| Molecular Weight | 232.10600 |
| Exact Mass | 231.02200 |
| PSA | 32.26000 |
| LogP | 3.00320 |
| InChIKey | DNMJYMJQRAHZNR-UHFFFAOYSA-N |
| SMILES | OCC1(Nc2cc(Cl)cc(Cl)c2)CC1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |