2,4,6-Trichlorophenylisothiocyanate
Modify Date: 2025-11-29 18:51:01
2,4,6-Trichlorophenylisothiocyanate structure
|
Common Name | 2,4,6-Trichlorophenylisothiocyanate | ||
|---|---|---|---|---|
| CAS Number | 861363-66-8 | Molecular Weight | 379.02600 | |
| Density | 1.59g/cm3 | Boiling Point | 474.5ºC at 760 mmHg | |
| Molecular Formula | C13H7Cl4N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.8ºC | |
| Name | 2,4,6-Trichlorophenylisothiocyanate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 474.5ºC at 760 mmHg |
| Molecular Formula | C13H7Cl4N3O2 |
| Molecular Weight | 379.02600 |
| Flash Point | 240.8ºC |
| Exact Mass | 376.92900 |
| PSA | 70.21000 |
| LogP | 6.16370 |
| Index of Refraction | 1.66 |
| InChIKey | VSXDLKGIUYKEGT-UYRXBGFRSA-N |
| SMILES | O=[N+]([O-])c1cccc(C(Cl)=NNc2c(Cl)cc(Cl)cc2Cl)c1 |
| HS Code | 2928000090 |
|---|
|
~%
2,4,6-Trichloro... CAS#:861363-66-8 |
| Literature: Chattaway; Walker Journal of the Chemical Society, 1925 , vol. 127, p. 1695 |
![N-[(3-nitrophenyl)methylideneamino]aniline structure](https://image.chemsrc.com/caspic/416/7539-23-3.png)
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:121-92-6| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-(2,4,6-Trichlorophenyl)-3-nitrobenzenecarbohydrazonoylchloride |
| 3-Nitro-N'-(2,4,6-trichlor-phenyl)-benzohydrazonoylchlorid |
| 3-nitro-N'-(2,4,6-trichloro-phenyl)-benzohydrazonoyl chloride |
| N-(2,4,6-Trichlorophenyl)-3 |