2-[4-(Trifluoromethyl)phenoxy]acetohydrazide structure
|
Common Name | 2-[4-(Trifluoromethyl)phenoxy]acetohydrazide | ||
|---|---|---|---|---|
| CAS Number | 860649-71-4 | Molecular Weight | 234.17500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(Trifluoromethyl)phenoxy]acetohydrazide |
|---|
| Molecular Formula | C9H9F3N2O2 |
|---|---|
| Molecular Weight | 234.17500 |
| Exact Mass | 234.06200 |
| PSA | 67.84000 |
| LogP | 2.61470 |
| InChIKey | QLRJAWXTNRAZNX-UHFFFAOYSA-N |
| SMILES | NNC(=O)COc1ccc(C(F)(F)F)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |