1H-1,2,4-Triazole-1-aceticacid,4,5-dihydro-4-(4-methylphenyl)-5-oxo- structure
|
Common Name | 1H-1,2,4-Triazole-1-aceticacid,4,5-dihydro-4-(4-methylphenyl)-5-oxo- | ||
|---|---|---|---|---|
| CAS Number | 860612-22-2 | Molecular Weight | 233.223 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 416.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C11H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.7±31.5 °C | |
| Name | 2-[4-(4-methylphenyl)-5-oxo-1,2,4-triazol-1-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 416.6±55.0 °C at 760 mmHg |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.223 |
| Flash Point | 205.7±31.5 °C |
| Exact Mass | 233.080048 |
| PSA | 77.12000 |
| LogP | -0.06 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | PPRJOVZBRBNZDJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2cnn(CC(=O)O)c2=O)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-1,2,4-Triazole-1-acetic acid, 4,5-dihydro-4-(4-methylphenyl)-5-oxo- |
| [4-(4-Methylphenyl)-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]acetic acid |
| 1H-1,2,4-Triazole-1-aceticacid,4,5-dihydro-4-(4-methylphenyl)-5-oxo- |