alpha-(3-Methoxyphenyl)-3-Methyloxybenzylamine
Modify Date: 2025-08-25 19:19:08
alpha-(3-Methoxyphenyl)-3-Methyloxybenzylamine structure
|
Common Name | alpha-(3-Methoxyphenyl)-3-Methyloxybenzylamine | ||
|---|---|---|---|---|
| CAS Number | 860598-16-9 | Molecular Weight | 243.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(3-methoxyphenyl)methanamine |
|---|
| Molecular Formula | C15H17NO2 |
|---|---|
| Molecular Weight | 243.30100 |
| Exact Mass | 243.12600 |
| PSA | 44.48000 |
| LogP | 3.45220 |
| InChIKey | PHVIVWGJFJLQLR-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(N)c2cccc(OC)c2)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |