CHEMBRDG-BB 9026382
Modify Date: 2025-08-25 12:26:21
CHEMBRDG-BB 9026382 structure
|
Common Name | CHEMBRDG-BB 9026382 | ||
|---|---|---|---|---|
| CAS Number | 85983-54-6 | Molecular Weight | 238.75600 | |
| Density | 1.105g/cm3 | Boiling Point | 383.2ºC at 760 mmHg | |
| Molecular Formula | C13H19ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.5ºC | |
| Name | 3-chloro-4-(3,5-dimethylpiperidin-1-yl)aniline |
|---|
| Density | 1.105g/cm3 |
|---|---|
| Boiling Point | 383.2ºC at 760 mmHg |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.75600 |
| Flash Point | 185.5ºC |
| Exact Mass | 238.12400 |
| PSA | 29.26000 |
| LogP | 4.05070 |
| Index of Refraction | 1.558 |
| InChIKey | DEZBYVVELTVSTE-UHFFFAOYSA-N |
| SMILES | CC1CC(C)CN(c2ccc(N)cc2Cl)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |