1-Naphthyl (4-chlorophenyl)carbamate structure
|
Common Name | 1-Naphthyl (4-chlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 85966-63-8 | Molecular Weight | 297.73600 | |
| Density | 1.35g/cm3 | Boiling Point | 437.1ºC at 760mmHg | |
| Molecular Formula | C17H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.2ºC | |
| Name | 1-Naphthyl (4-chlorophenyl)carbamate |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 437.1ºC at 760mmHg |
| Molecular Formula | C17H12ClNO2 |
| Molecular Weight | 297.73600 |
| Flash Point | 218.2ºC |
| Exact Mass | 297.05600 |
| PSA | 38.33000 |
| LogP | 5.17710 |
| Index of Refraction | 1.696 |
| InChIKey | OINVYIJNFZHAHK-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)Oc1cccc2ccccc12 |
| HS Code | 2924299090 |
|---|
|
~%
1-Naphthyl (4-c... CAS#:85966-63-8 |
| Literature: Kao; Fang; Sah Sci.Rep.Tsing Hua Univ., 1936 , vol. 3, p. 109,110,111 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |