Benzoic acid, 4-nitro-,2-chlorophenyl ester structure
|
Common Name | Benzoic acid, 4-nitro-,2-chlorophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 85965-91-9 | Molecular Weight | 277.66000 | |
| Density | 1.412g/cm3 | Boiling Point | 472.4ºC at 760mmHg | |
| Molecular Formula | C13H8ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.5ºC | |
| Name | (2-chlorophenyl) 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 472.4ºC at 760mmHg |
| Molecular Formula | C13H8ClNO4 |
| Molecular Weight | 277.66000 |
| Flash Point | 239.5ºC |
| Exact Mass | 277.01400 |
| PSA | 72.12000 |
| LogP | 3.99060 |
| Index of Refraction | 1.622 |
| InChIKey | OFIWZIJKZNBSHV-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1Cl)c1ccc([N+](=O)[O-])cc1 |
|
~99%
Benzoic acid, 4... CAS#:85965-91-9 |
| Literature: Won, Ju-Eun; Kim, Ho-Kyun; Kim, Jeum-Jong; Yim, Heong-Seup; Kim, Min-Jung; Kang, Seung-Beom; Chung, Hyun-A.; Lee, Sang-Gyeong; Yoon, Yong-Jin Tetrahedron, 2007 , vol. 63, # 51 p. 12720 - 12730 |
|
~%
Benzoic acid, 4... CAS#:85965-91-9 |
|
Literature: Vogel,A.I. Text-Book of Practical Organic Chemistry, 1. Aufl. |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-chlorophenyl 4-nitrobenzoate |
| 4-Nitro-benzoesaeure-(2-chlor-phenylester) |
| 4-Nitrobenzoic acid,2-chlorophenyl ester |