N-[1-[2-(4-isothiocyanatophenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide structure
|
Common Name | N-[1-[2-(4-isothiocyanatophenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 85951-63-9 | Molecular Weight | 393.54500 | |
| Density | 1.12g/cm3 | Boiling Point | 541.1ºC at 760 mmHg | |
| Molecular Formula | C23H27N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.1ºC | |
| Name | N-[1-[2-(4-isothiocyanatophenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 541.1ºC at 760 mmHg |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.54500 |
| Flash Point | 281.1ºC |
| Exact Mass | 393.18700 |
| PSA | 68.00000 |
| LogP | 4.80890 |
| Index of Refraction | 1.603 |
| InChIKey | VDKBIFPJULZUPU-UHFFFAOYSA-N |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2ccc(N=C=S)cc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~50%
N-[1-[2-(4-isot... CAS#:85951-63-9 |
| Literature: Burke Jr.; Bajwa; Jacobson; Rice; Streaty; Klee Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1570 - 1574 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Fentanyl isothiocyanate |
| Fit alkylating agent |
| Fentanyl ncs |
| Tocris-1480 |