N-[4-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]acetamide structure
|
Common Name | N-[4-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 85868-54-8 | Molecular Weight | 383.48400 | |
| Density | 1.153g/cm3 | Boiling Point | 611.3ºC at 760 mmHg | |
| Molecular Formula | C22H29N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.5ºC | |
| Name | N-[4-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 611.3ºC at 760 mmHg |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.48400 |
| Flash Point | 323.5ºC |
| Exact Mass | 383.22100 |
| PSA | 57.53000 |
| LogP | 3.89710 |
| Index of Refraction | 1.583 |
| InChIKey | LWARGZCXOMASHN-UHFFFAOYSA-N |
| SMILES | COc1cccc(N2CCN(CCCOc3ccc(NC(C)=O)cc3)CC2)c1 |
|
~77%
N-[4-[3-[4-(3-m... CAS#:85868-54-8 |
| Literature: Agarwal, Shiv K.; Saxena, Anil K.; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 10 p. 914 - 918 |
|
~%
N-[4-[3-[4-(3-m... CAS#:85868-54-8 |
| Literature: Agarwal, Shiv K.; Saxena, Anil K.; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 10 p. 914 - 918 |
| N-(4-(3-(4-(3-Methoxyphenyl)-1-piperazinyl)propoxy)phenyl)acetamide |
| ACETAMIDE,N-(4-(3-(4-(3-METHOXYPHENYL)-1-PIPERAZINYL)PROPOXY)PHENYL) |
| 1-(4-acetamidophenoxy)-3-<N1-(N4-(3-methoxyphenyl)piperazinyl)>propane |
| LS-9859 |