2-Thiophenecarboxaldehyde,2-(2-quinolinyl)hydrazone structure
|
Common Name | 2-Thiophenecarboxaldehyde,2-(2-quinolinyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 85754-45-6 | Molecular Weight | 253.32200 | |
| Density | 1.25g/cm3 | Boiling Point | 445.7ºC at 760mmHg | |
| Molecular Formula | C14H11N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | N-[(E)-thiophen-2-ylmethylideneamino]quinolin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 445.7ºC at 760mmHg |
| Molecular Formula | C14H11N3S |
| Molecular Weight | 253.32200 |
| Flash Point | 223.4ºC |
| Exact Mass | 253.06700 |
| PSA | 68.75000 |
| LogP | 3.16420 |
| Index of Refraction | 1.685 |
| InChIKey | JAJLLNOFBUNSIC-XNTDXEJSSA-N |
| SMILES | C(=NNc1ccc2ccccc2n1)c1cccs1 |
|
~63%
2-Thiophenecarb... CAS#:85754-45-6 |
| Literature: Berge, Douglas G. Journal of Chemical & Engineering Data, 1983 , vol. 28, # 4 p. 431 - 432 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| t0518-5392 |