2,2,3,4,4-pentachloro-3-butenoic acid
Modify Date: 2025-09-18 10:42:08
2,2,3,4,4-pentachloro-3-butenoic acid structure
|
Common Name | 2,2,3,4,4-pentachloro-3-butenoic acid | ||
|---|---|---|---|---|
| CAS Number | 85743-61-9 | Molecular Weight | 258.31500 | |
| Density | 1.853g/cm3 | Boiling Point | 274.8ºC at 760 mmHg | |
| Molecular Formula | C4HCl5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120ºC | |
| Name | 2,2,3,4,4-pentachlorobut-3-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.853g/cm3 |
|---|---|
| Boiling Point | 274.8ºC at 760 mmHg |
| Molecular Formula | C4HCl5O2 |
| Molecular Weight | 258.31500 |
| Flash Point | 120ºC |
| Exact Mass | 255.84200 |
| PSA | 37.30000 |
| LogP | 3.13040 |
| Index of Refraction | 1.575 |
| InChIKey | CKGWGTNKIWPBKE-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cl)(Cl)C(Cl)=C(Cl)Cl |
| HS Code | 2916190090 |
|---|
|
~%
2,2,3,4,4-penta... CAS#:85743-61-9 |
| Literature: Roedig; Bernemann Justus Liebigs Annalen der Chemie, 1956 , vol. 600, p. 1,10 |
|
~%
2,2,3,4,4-penta... CAS#:85743-61-9 |
| Literature: Roedig; Bernemann Justus Liebigs Annalen der Chemie, 1956 , vol. 600, p. 1,10 |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 2,2,3,4,4-Pentachlor-3-butensaeure |
| 3-Butanoic acid,2,2,3,4,4-pentachloro |
| 3-BUTENOIC ACID,2,2,3,4,4-PENTACHLORO |
| Pentachlor-but-3-ensaeure |
| 3-Butenoic acid,pentachloro |
| 2,2,3,4,4-Pentachloro-3-butenoic acid |
| Pentachloro-3-butenoic acid |
| Perchlorvinylessigsaeure |
| pentachloro-but-3-enoic acid |