Butanamide,3-oxo-N-(1-phenylethyl)-
Modify Date: 2025-09-23 18:25:33
Butanamide,3-oxo-N-(1-phenylethyl)- structure
|
Common Name | Butanamide,3-oxo-N-(1-phenylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 85729-63-1 | Molecular Weight | 205.25300 | |
| Density | 1.068g/cm3 | Boiling Point | 393.5ºC at 760 mmHg | |
| Molecular Formula | C12H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.6ºC | |
| Name | 3-oxo-N-(1-phenylethyl)butanamide |
|---|
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 393.5ºC at 760 mmHg |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25300 |
| Flash Point | 163.6ºC |
| Exact Mass | 205.11000 |
| PSA | 46.17000 |
| LogP | 2.23380 |
| Index of Refraction | 1.515 |
| InChIKey | ZUBWRZYVHWXVPS-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC(C)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~89%
Butanamide,3-ox... CAS#:85729-63-1 |
| Literature: Hudlicky, T.; Gillman, Gene; Andersen, Catherine Tetrahedron: Asymmetry, 1992 , vol. 3, # 2 p. 281 - 286 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |