Heptanal,2-[(4-methoxyphenyl)methylene]- structure
|
Common Name | Heptanal,2-[(4-methoxyphenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 85711-94-0 | Molecular Weight | 232.31800 | |
| Density | 0.992g/cm3 | Boiling Point | 369.7ºC at 760 mmHg | |
| Molecular Formula | C15H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158ºC | |
| Name | 2-[(4-methoxyphenyl)methylidene]heptanal |
|---|---|
| Synonym | More Synonyms |
| Density | 0.992g/cm3 |
|---|---|
| Boiling Point | 369.7ºC at 760 mmHg |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.31800 |
| Flash Point | 158ºC |
| Exact Mass | 232.14600 |
| PSA | 26.30000 |
| LogP | 3.85780 |
| Index of Refraction | 1.527 |
| InChIKey | ULNWJBBIVSQKGC-SDNWHVSQSA-N |
| SMILES | CCCCCC(C=O)=Cc1ccc(OC)cc1 |
| HS Code | 2912499000 |
|---|
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-[(4-Methoxyphenyl)methylene]heptanal |
| 2-[(4-methoxyphenyl)methylene]heptan-1-al |
| (E)-2-(4-methoxybenzylidene)heptanal |