1,5-diphenyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyrazol-3-one
Modify Date: 2025-09-18 17:08:02
![1,5-diphenyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyrazol-3-one Structure](https://image.chemsrc.com/caspic/308/85673-87-6.png)
1,5-diphenyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyrazol-3-one structure
|
Common Name | 1,5-diphenyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 85673-87-6 | Molecular Weight | 439.55200 | |
| Density | 1.21g/cm3 | Boiling Point | 625ºC at 760 mmHg | |
| Molecular Formula | C27H29N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.8ºC | |
| Name | 1,5-diphenyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 625ºC at 760 mmHg |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.55200 |
| Flash Point | 331.8ºC |
| Exact Mass | 439.23700 |
| PSA | 46.30000 |
| LogP | 3.91620 |
| Index of Refraction | 1.633 |
| InChIKey | NOSNJBQFOSLJCA-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)n(-c2ccccc2)n1CCCN1CCN(c2ccccn2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Revenastum [Latin] |
| Revenastum |
| 2,3-Diphenyl-1-(3-(4-(2-pyridyl)-1-piperazinyl)propyl)-3-pyrazolin-5-one |
| Revenast |
| UNII-24G45TQO8A |