Benzenesulfonic acid, 2,4,6-trimethyl-, 2-chloroethyl ester structure
|
Common Name | Benzenesulfonic acid, 2,4,6-trimethyl-, 2-chloroethyl ester | ||
|---|---|---|---|---|
| CAS Number | 85650-10-8 | Molecular Weight | 262.75300 | |
| Density | 1.226g/cm3 | Boiling Point | 411.4ºC at 760mmHg | |
| Molecular Formula | C11H15ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.6ºC | |
| Name | 2-chloroethyl 2,4,6-trimethylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 411.4ºC at 760mmHg |
| Molecular Formula | C11H15ClO3S |
| Molecular Weight | 262.75300 |
| Flash Point | 202.6ºC |
| Exact Mass | 262.04300 |
| PSA | 51.75000 |
| LogP | 3.63670 |
| Index of Refraction | 1.521 |
| InChIKey | YUGYVJZSOQHHFC-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(S(=O)(=O)OCCCl)c(C)c1 |
|
~73%
Benzenesulfonic... CAS#:85650-10-8 |
| Literature: Shealy, Y. Fulmer; Krauth, Charles A.; Struck, Robert F.; Montgomery, John A. Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1168 - 1173 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenesulfonic acid,2,4,6-trimethyl-,2-chloroethyl ester |