1-(2-chloroethoxysulfonyl)-2,3,4,5,6-pentamethyl-benzene structure
|
Common Name | 1-(2-chloroethoxysulfonyl)-2,3,4,5,6-pentamethyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 85650-09-5 | Molecular Weight | 290.80600 | |
| Density | 1.178g/cm3 | Boiling Point | 440.7ºC at 760 mmHg | |
| Molecular Formula | C13H19ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.3ºC | |
| Name | 2-chloroethyl 2,3,4,5,6-pentamethylbenzenesulfonate |
|---|
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 440.7ºC at 760 mmHg |
| Molecular Formula | C13H19ClO3S |
| Molecular Weight | 290.80600 |
| Flash Point | 220.3ºC |
| Exact Mass | 290.07400 |
| PSA | 51.75000 |
| LogP | 4.25350 |
| Index of Refraction | 1.515 |
| InChIKey | NNBWRDBDAWVRHO-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)OCCCl)c(C)c1C |
|
~48%
1-(2-chloroetho... CAS#:85650-09-5 |
| Literature: Shealy, Y. Fulmer; Krauth, Charles A.; Struck, Robert F.; Montgomery, John A. Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1168 - 1173 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |