2-chloro-N-(4-cyclopentylphenyl)acetamide structure
|
Common Name | 2-chloro-N-(4-cyclopentylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 85603-01-6 | Molecular Weight | 237.72500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-N-(4-cyclopentylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16ClNO |
|---|---|
| Molecular Weight | 237.72500 |
| Exact Mass | 237.09200 |
| PSA | 29.10000 |
| LogP | 3.59450 |
| InChIKey | CSWHXUXFBXCCFN-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ccc(C2CCCC2)cc1 |
|
~90%
2-chloro-N-(4-c... CAS#:85603-01-6 |
| Literature: Vejdelek; Bartosova; Protiva Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 1 p. 156 - 162 |
|
~%
2-chloro-N-(4-c... CAS#:85603-01-6 |
| Literature: Vejdelek; Bartosova; Protiva Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 1 p. 156 - 162 |
| Acetamide,2-chloro-N-(4-cyclopentylphenyl) |
| N-(4-Cyclopentylphenyl)chloroacetamide |