4,6'-Dichloro-2,2'-bipyridine
Modify Date: 2025-08-26 22:17:58
4,6'-Dichloro-2,2'-bipyridine structure
|
Common Name | 4,6'-Dichloro-2,2'-bipyridine | ||
|---|---|---|---|---|
| CAS Number | 85591-65-7 | Molecular Weight | 225.074 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 344.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H6Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.6±12.1 °C | |
| Name | 2-chloro-6-(4-chloropyridin-2-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 344.1±37.0 °C at 760 mmHg |
| Molecular Formula | C10H6Cl2N2 |
| Molecular Weight | 225.074 |
| Flash Point | 192.6±12.1 °C |
| Exact Mass | 223.990799 |
| PSA | 25.78000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | BPLWIHFOULBPJP-UHFFFAOYSA-N |
| SMILES | Clc1ccnc(-c2cccc(Cl)n2)c1 |
| HS Code | 2933399090 |
|---|
|
~20%
4,6'-Dichloro-2... CAS#:85591-65-7 |
| Literature: Constable, Edwin C.; Seddon, Kenneth R. Tetrahedron, 1983 , vol. 39, # 2 p. 291 - 296 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6'-Dichloro-2,2'-bipyridine |
| 2,2'-Bipyridine, 4,6'-dichloro- |