2,4-Pyrimidinediamine, 5-((4-ethoxy-3-methoxyphenyl)methyl)-
Modify Date: 2025-09-26 17:58:29
2,4-Pyrimidinediamine, 5-((4-ethoxy-3-methoxyphenyl)methyl)- structure
|
Common Name | 2,4-Pyrimidinediamine, 5-((4-ethoxy-3-methoxyphenyl)methyl)- | ||
|---|---|---|---|---|
| CAS Number | 85544-41-8 | Molecular Weight | 274.31800 | |
| Density | 1.222g/cm3 | Boiling Point | 512ºC at 760 mmHg | |
| Molecular Formula | C14H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.4ºC | |
| Name | 5-[(4-ethoxy-3-methoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 512ºC at 760 mmHg |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.31800 |
| Flash Point | 263.4ºC |
| Exact Mass | 274.14300 |
| PSA | 97.74000 |
| LogP | 1.49930 |
| Index of Refraction | 1.614 |
| InChIKey | DRVXIPMHENHGQH-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(Cc2cnc(N)nc2N)cc1OC |
| HS Code | 2933599090 |
|---|
|
~%
2,4-Pyrimidined... CAS#:85544-41-8 |
| Literature: Hachtel; Haller; Seydel Arzneimittel-Forschung/Drug Research, 1988 , vol. 38, # 12 p. 1778 - 1783 |
|
~%
2,4-Pyrimidined... CAS#:85544-41-8 |
| Literature: Hachtel; Haller; Seydel Arzneimittel-Forschung/Drug Research, 1988 , vol. 38, # 12 p. 1778 - 1783 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |