N-[4-bromo-2-(2-fluorobenzoyl)phenyl]-2-chloroacetamide
Modify Date: 2025-09-02 12:55:52
![N-[4-bromo-2-(2-fluorobenzoyl)phenyl]-2-chloroacetamide Structure](https://image.chemsrc.com/caspic/138/85508-36-7.png)
N-[4-bromo-2-(2-fluorobenzoyl)phenyl]-2-chloroacetamide structure
|
Common Name | N-[4-bromo-2-(2-fluorobenzoyl)phenyl]-2-chloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 85508-36-7 | Molecular Weight | 370.60100 | |
| Density | 1.594g/cm3 | Boiling Point | 576ºC at 760 mmHg | |
| Molecular Formula | C15H10BrClFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.2ºC | |
| Name | N-[4-bromo-2-(2-fluorobenzoyl)phenyl]-2-chloroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.594g/cm3 |
|---|---|
| Boiling Point | 576ºC at 760 mmHg |
| Molecular Formula | C15H10BrClFNO2 |
| Molecular Weight | 370.60100 |
| Flash Point | 302.2ºC |
| Exact Mass | 368.95700 |
| PSA | 46.17000 |
| LogP | 4.06950 |
| Index of Refraction | 1.631 |
| InChIKey | HOQSGKIDIDLTAG-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ccc(Br)cc1C(=O)c1ccccc1F |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 287-461-3 |
| 2-chloroacetamido-2'-fluoro-5-bromobenzophenone |