Benzenemethanamine,N-[3-(methylthio)propyl]-4-nitro-, monohydrochloride (9CI) structure
|
Common Name | Benzenemethanamine,N-[3-(methylthio)propyl]-4-nitro-, monohydrochloride (9CI) | ||
|---|---|---|---|---|
| CAS Number | 85485-87-6 | Molecular Weight | 276.78300 | |
| Density | 1.164g/cm3 | Boiling Point | 390.1ºC at 760mmHg | |
| Molecular Formula | C11H17ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.7ºC | |
| Name | 3-methylsulfanyl-N-[(4-nitrophenyl)methyl]propan-1-amine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 390.1ºC at 760mmHg |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.78300 |
| Flash Point | 189.7ºC |
| Exact Mass | 276.07000 |
| PSA | 83.15000 |
| LogP | 4.15360 |
| Index of Refraction | 1.571 |
| InChIKey | QAGFOLBUNKQALC-UHFFFAOYSA-N |
| SMILES | CSCCCNCc1ccc([N+](=O)[O-])cc1.Cl |
|
~%
Benzenemethanam... CAS#:85485-87-6 |
| Literature: Swank, Darrel W.; Lambeth, David O. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 1515 - 1520 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-p-nitrobenzyl-3-methylthiopropylamine hydrochloride |