tris(2,5-dimethoxyphenyl)phosphane
Modify Date: 2025-11-23 21:11:47
tris(2,5-dimethoxyphenyl)phosphane structure
|
Common Name | tris(2,5-dimethoxyphenyl)phosphane | ||
|---|---|---|---|---|
| CAS Number | 85417-61-4 | Molecular Weight | 442.44100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H27O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris(2,5-dimethoxyphenyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H27O6P |
|---|---|
| Molecular Weight | 442.44100 |
| Exact Mass | 442.15500 |
| PSA | 68.97000 |
| LogP | 3.49640 |
| InChIKey | VMFMHGFERNHYIV-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(P(c2cc(OC)ccc2OC)c2cc(OC)ccc2OC)c1 |
|
~%
tris(2,5-dimeth... CAS#:85417-61-4 |
| Literature: Horner, L.; Simons, G. Phosphorus and Sulfur and the Related Elements, 1983 , vol. 14, p. 189 - 210 |
| Phosphine,tris(2,5-dimethoxyphenyl) |
| Tris-(2,5-dimethoxyphenyl)-phosphin |