bz-dmt-deoxycytidine 2-clph diester*triethylammon structure
|
Common Name | bz-dmt-deoxycytidine 2-clph diester*triethylammon | ||
|---|---|---|---|---|
| CAS Number | 85381-24-4 | Molecular Weight | 925.40100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C49H54ClN4O10P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5'-O-(dimethoxytrityl)-N-benzoyl-2'-deoxycytidine 3'-(o-chlorophenyl phosphate) triethylammonium salt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C49H54ClN4O10P |
|---|---|
| Molecular Weight | 925.40100 |
| Exact Mass | 924.32700 |
| PSA | 169.72000 |
| LogP | 9.44810 |
| InChIKey | IHCAQPYUATVUIY-BQCABBGESA-N |
| SMILES | CCN(CC)CC.COc1ccc(C(OCC2OC(n3ccc(NC(=O)c4ccccc4)nc3=O)CC2OP(=O)(O)Oc2ccccc2Cl)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Phosphoric acid (2R,3S,5R)-5-(4-benzoylamino-2-oxo-2H-pyrimidin-1-yl)-2-[bis-(4-methoxy-phenyl)-phenyl-methoxymethyl]-tetrahydro-furan-3-yl ester 2-chloro-phenyl ester |
| compound with triethyl-amine |
| 5'-O-(dimethoxytrityl)-N-benzoyl-2'-deoxycytidine 3'-(o-chlorophenyl) phosphate triethylammonium salt |
| N-benzoyl-5'-O-(bis(4-methoxyphenyl)phenylmethyl)-2'-deoxy-3'-cytidylic acid, mono(2-chlorophenyl) ester, compd. with N,N-diethylethanamine (1:1) |