CL-2660 structure
|
Common Name | CL-2660 | ||
|---|---|---|---|---|
| CAS Number | 853694-34-5 | Molecular Weight | 234.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CL-2660antioxidant activity; lead candidates in drug developments of anti-MIF drugs; antioxidant and anti-inflammatory activities; bacteriostatic and fungistatic activity; antioxidant activity; lead candidates in drug developments of anti-MIF drugs; antioxidant and anti-inflammatory activities; bacteriostatic and fungistatic activity; |
| Name | CL-2660 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10O5 |
|---|---|
| Molecular Weight | 234.2 |
| InChIKey | CCCOUORAUKBTBH-UHFFFAOYSA-N |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C(=O)N3CCC(C)CC3)cc2)cc1 |
| Benzenesulfonamide, N-(4-methoxyphenyl)-4-[(4-methyl-1-piperidinyl)carbonyl]- |