4-Chloro-7-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine
Modify Date: 2025-08-21 18:42:42
![4-Chloro-7-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine Structure](https://image.chemsrc.com/caspic/432/853680-76-9.png)
4-Chloro-7-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine structure
|
Common Name | 4-Chloro-7-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 853680-76-9 | Molecular Weight | 275.733 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 473.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H14ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.4±28.7 °C | |
| Name | 4-Chloro-7-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 473.9±45.0 °C at 760 mmHg |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.733 |
| Flash Point | 240.4±28.7 °C |
| Exact Mass | 275.082550 |
| PSA | 38.25000 |
| LogP | 3.15 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | DPPLCQFHORWGCK-UHFFFAOYSA-N |
| SMILES | COc1ccc(CN2CCc3c(Cl)ncnc32)cc1 |
| HS Code | 2933990090 |
|---|
|
~71%
4-Chloro-7-(4-m... CAS#:853680-76-9 |
| Literature: ARRAY BIOPHARMA INC. Patent: WO2005/51304 A2, 2005 ; Location in patent: Page/Page column 155-157 ; WO 2005/051304 A2 |
|
~%
4-Chloro-7-(4-m... CAS#:853680-76-9 |
| Literature: WO2014/19908 A2, ; |
|
~%
4-Chloro-7-(4-m... CAS#:853680-76-9 |
| Literature: WO2014/19908 A2, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-7-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine |
| 5H-Pyrrolo[2,3-d]pyrimidine, 4-chloro-6,7-dihydro-7-[(4-methoxyphenyl)methyl]- |
| 4-chloro-7-[(4-methoxyphenyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidine |