1-tert-Butyl 3-Methyl 2,2-dimethylMalonate
Modify Date: 2025-09-10 16:17:08
1-tert-Butyl 3-Methyl 2,2-dimethylMalonate structure
|
Common Name | 1-tert-Butyl 3-Methyl 2,2-dimethylMalonate | ||
|---|---|---|---|---|
| CAS Number | 85293-46-5 | Molecular Weight | 202.24800 | |
| Density | 1.008g/cm3 | Boiling Point | 190.87ºC at 760 mmHg | |
| Molecular Formula | C10H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 76.533ºC | |
| Name | 3-O-tert-butyl 1-O-methyl 2,2-dimethylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.008g/cm3 |
|---|---|
| Boiling Point | 190.87ºC at 760 mmHg |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.24800 |
| Flash Point | 76.533ºC |
| Exact Mass | 202.12100 |
| PSA | 52.60000 |
| LogP | 1.52730 |
| Index of Refraction | 1.43 |
| InChIKey | ZXTMFWHKFMRXOI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)(C)C(=O)OC(C)(C)C |
| HS Code | 2917190090 |
|---|
|
~%
1-tert-Butyl 3-... CAS#:85293-46-5 |
| Literature: TANABE SEIYAKU CO., LTD. Patent: WO2007/116922 A1, 2007 ; Location in patent: Page/Page column 51 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| X2029 |
| Propanedioic acid,dimethyl-,1,1-dimethylethyl methyl ester |
| 1-Tert-butyl 3-methyl 2,2-dimethylmalonate |
| tert-butyl methyl 2,2-dimethyl-malonate |