(4-formylphenyl) 3-phenylprop-2-enoate
Modify Date: 2025-09-18 11:12:14
(4-formylphenyl) 3-phenylprop-2-enoate structure
|
Common Name | (4-formylphenyl) 3-phenylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 85238-61-5 | Molecular Weight | 252.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-formylphenyl) 3-phenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12O3 |
|---|---|
| Molecular Weight | 252.26500 |
| Exact Mass | 252.07900 |
| PSA | 43.37000 |
| LogP | 3.11790 |
| InChIKey | ASHIAZHAFARVET-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(OC(=O)C=Cc2ccccc2)cc1 |
|
~88%
(4-formylphenyl... CAS#:85238-61-5 |
| Literature: Jeon, Jae-Ho; Yang, Deok-Mo; Jun, Jong-Gab Bulletin of the Korean Chemical Society, 2011 , vol. 32, # 1 p. 65 - 70 |
| 2-Propenoic acid,3-phenyl-,4-formylphenyl ester |
| 4-formyl cinnamate |