15-deoxy-Δ12,14-Prostaglandin D2 (15-deoxy-Δ12,14-PGD2)
Modify Date: 2024-09-08 21:06:05
15-deoxy-Δ12,14-Prostaglandin D2 (15-deoxy-Δ12,14-PGD2) structure
|
Common Name | 15-deoxy-Δ12,14-Prostaglandin D2 (15-deoxy-Δ12,14-PGD2) | ||
|---|---|---|---|---|
| CAS Number | 85235-11-6 | Molecular Weight | 334.450 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 535.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.4±26.6 °C | |
Use of 15-deoxy-Δ12,14-Prostaglandin D2 (15-deoxy-Δ12,14-PGD2)15-deoxy-Δ12,14-PGD2 is a metabolite of PGD2 .1 It is an agonist of PGD2 receptor 2 (DP2) that binds DP2 (Ki = 50 nM for the mouse receptor expressed in HEK293 cell membranes) and induces activation of eosinophils |
| Name | 7-[(1R,5S)-5-hydroxy-2-oct-2-enylidene-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 535.0±50.0 °C at 760 mmHg |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.450 |
| Flash Point | 291.4±26.6 °C |
| Exact Mass | 334.214417 |
| PSA | 74.60000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | QUGBPWLPAUHDTI-UHFFFAOYSA-N |
| SMILES | CCCCCC=CC=C1C(=O)CC(O)C1CC=CCCCC(=O)O |
| (5Z,9α,12E,14E)-9-Hydroxy-11-oxoprosta-5,12,14-trien-1-oic acid |
| Prosta-5,12,14-trien-1-oic acid, 9-hydroxy-11-oxo-, (5Z,9α,12E,14E)- |