7H-Furo[3,2-g][1]benzopyran-7-one,9-[(6-bromohexyl)oxy]- structure
|
Common Name | 7H-Furo[3,2-g][1]benzopyran-7-one,9-[(6-bromohexyl)oxy]- | ||
|---|---|---|---|---|
| CAS Number | 85213-86-1 | Molecular Weight | 365.21800 | |
| Density | 1.439g/cm3 | Boiling Point | 515.3ºC at 760 mmHg | |
| Molecular Formula | C17H17BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.5ºC | |
| Name | 9-(6-bromohexoxy)furo[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 515.3ºC at 760 mmHg |
| Molecular Formula | C17H17BrO4 |
| Molecular Weight | 365.21800 |
| Flash Point | 265.5ºC |
| Exact Mass | 364.03100 |
| PSA | 52.58000 |
| LogP | 4.87330 |
| Index of Refraction | 1.605 |
| InChIKey | NBKLCRUOMQCFGE-UHFFFAOYSA-N |
| SMILES | O=c1ccc2cc3ccoc3c(OCCCCCCBr)c2o1 |
|
~86%
7H-Furo[3,2-g][... CAS#:85213-86-1 |
| Literature: Silver, Gail C.; Trogler, William C. Journal of the American Chemical Society, 1995 , vol. 117, # 14 p. 3983 - 3993 |
|
~%
7H-Furo[3,2-g][... CAS#:85213-86-1 |
| Literature: Silver, Gail C.; Trogler, William C. Journal of the American Chemical Society, 1995 , vol. 117, # 14 p. 3983 - 3993 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 8-((6-bromohexyl-1)oxy)psoralen |
| 8-(6'-bromohexyloxy)psoralen |
| 9-((6-Bromohexyl)oxy)-7H-furo[3,2-g]chromen-7-one |