Tipredane structure
|
Common Name | Tipredane | ||
|---|---|---|---|---|
| CAS Number | 85197-77-9 | Molecular Weight | 410.60900 | |
| Density | 1.23g/cm3 | Boiling Point | 545ºC at 760 mmHg | |
| Molecular Formula | C22H31FO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.4ºC | |
| Name | (8ξ,10ξ,13ξ,14ξ,17β)-17-(Ethylsulfanyl)-9-fluoro-11-hydroxy-17-(m ethylsulfanyl)androsta-1,4-dien-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 545ºC at 760 mmHg |
| Molecular Formula | C22H31FO2S2 |
| Molecular Weight | 410.60900 |
| Flash Point | 283.4ºC |
| Exact Mass | 410.17500 |
| PSA | 87.90000 |
| LogP | 5.16960 |
| Index of Refraction | 1.597 |
| InChIKey | DXEXNWDGDYUITL-FXSSSKFRSA-N |
| SMILES | CCSC1(SC)CCC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
|
~%
Tipredane CAS#:85197-77-9 |
| Literature: E.R. SQUIBB and SONS, INC. Patent: EP524813 A1, 1993 ; |
| (3S,5R,6R,7R,8R,9S,10R,13S,14S,15S,16S,17S)-octadecahydro-17-(3-hydroxy-1-propynyl)-10,13-dimethyl-5H-dicyclopropa[6,7:15,16]cyclopenta[a]phenanthrene-3,5,17-triol |
| 17-(3-Hydroxy-1-propynyl)-6|A,7|A:15|A,16|A-dimethyleneandrostane-3|A,5|A,17|A-triol |