2-tert-butylperoxy-2,4,4-trimethylpentane structure
|
Common Name | 2-tert-butylperoxy-2,4,4-trimethylpentane | ||
|---|---|---|---|---|
| CAS Number | 85153-88-4 | Molecular Weight | 202.33400 | |
| Density | 0.844g/cm3 | Boiling Point | 210.9ºC at 760 mmHg | |
| Molecular Formula | C12H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 42.6ºC | |
| Name | 2-tert-butylperoxy-2,4,4-trimethylpentane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.844g/cm3 |
|---|---|
| Boiling Point | 210.9ºC at 760 mmHg |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.33400 |
| Flash Point | 42.6ºC |
| Exact Mass | 202.19300 |
| PSA | 18.46000 |
| LogP | 3.94790 |
| Index of Refraction | 1.423 |
| InChIKey | POHYRDMTJGJYHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)OOC(C)(C)C |
| HS Code | 2909600000 |
|---|
|
~%
2-tert-butylper... CAS#:85153-88-4 |
| Literature: Matsuyama, Kazuo; Higuchi, Yoshiki Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 1 p. 259 - 265 |
| HS Code | 2909600000 |
|---|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| t-butyl 1,1,3,3-tetramethylbutyl peroxide |
| tert-butyl 1,1,3,3-tetramethylbutyl peroxide |
| 2,2,4-trimethyl-4-tert-butylperoxy-pentane |
| EINECS 285-873-8 |